C24H33FO2 — CID 67651623
2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]but-2-enoic acid (PubChem CID 67651623) has the molecular formula C24H33FO2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]but-2-enoic acid.
| Compound Name | 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67651623 |
| Molecular Formula | C24H33FO2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]but-2-enoic acid |
| SMILES | CC=C(C(=O)O)C1CCC(C2CCC(CCc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H33FO2/c1-2-23(24(26)27)21-13-11-20(12-14-21)19-9-5-17(6-10-19)3-4-18-7-15-22(25)16-8-18/h2,7-8,15-17,19-21H,3-6,9-14H2,1H3,(H,26,27) |
| InChIKey | WFKALPURXONXEF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|