C15H19F4NO2 — CID 134366951
4-[2-(4-fluorophenyl)ethyl]piperidine;2,2,2-trifluoroacetic acid (PubChem CID 134366951) has the molecular formula C15H19F4NO2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethyl]piperidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-(4-fluorophenyl)ethyl]piperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134366951 |
| Molecular Formula | C15H19F4NO2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethyl]piperidine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccc(CCC2CCNCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18FN.C2HF3O2/c14-13-5-3-11(4-6-13)1-2-12-7-9-15-10-8-12;3-2(4,5)1(6)7/h3-6,12,15H,1-2,7-10H2;(H,6,7) |
| InChIKey | LFGLKXDNGGXFOH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |