C13H18ClNO2 — CID 126844922
4-(2-pyrrolidin-3-ylethyl)benzoic acid;hydrochloride (PubChem CID 126844922) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is 4-(2-pyrrolidin-3-ylethyl)benzoic acid;hydrochloride.
| Compound Name | 4-(2-pyrrolidin-3-ylethyl)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 126844922 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-(2-pyrrolidin-3-ylethyl)benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CCC2CCNC2)cc1 |
| InChI | InChI=1S/C13H17NO2.ClH/c15-13(16)12-5-3-10(4-6-12)1-2-11-7-8-14-9-11;/h3-6,11,14H,1-2,7-9H2,(H,15,16);1H |
| InChIKey | PVDRGGBFQCQMTA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |