C28H39FSi — CID 54468401
4-[4-[2-[4-(4-fluorophenyl)phenyl]ethyl]cyclohexyl]-1-propylsilinane (PubChem CID 54468401) has the molecular formula C28H39FSi and a molecular weight of 422.70 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-fluorophenyl)phenyl]ethyl]cyclohexyl]-1-propylsilinane.
| Compound Name | 4-[4-[2-[4-(4-fluorophenyl)phenyl]ethyl]cyclohexyl]-1-propylsilinane |
|---|---|
| PubChem CID | 54468401 |
| Molecular Formula | C28H39FSi |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 4-[4-[2-[4-(4-fluorophenyl)phenyl]ethyl]cyclohexyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(C2CCC(CCc3ccc(-c4ccc(F)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H39FSi/c1-2-19-30-20-17-27(18-21-30)25-11-7-23(8-12-25)4-3-22-5-9-24(10-6-22)26-13-15-28(29)16-14-26/h5-6,9-10,13-16,23,25,27,30H,2-4,7-8,11-12,17-21H2,1H3 |
| InChIKey | XGOVNAWWLHNCOE-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|