C26H43FOSi — CID 54304468
4-[4-[4-[4-(2-fluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane (PubChem CID 54304468) has the molecular formula C26H43FOSi and a molecular weight of 418.71 g/mol. Its IUPAC name is 4-[4-[4-[4-(2-fluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane.
| Compound Name | 4-[4-[4-[4-(2-fluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane |
|---|---|
| PubChem CID | 54304468 |
| Molecular Formula | C26H43FOSi |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 4-[4-[4-[4-(2-fluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(C2CCC(CCCCc3ccc(OCCF)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H43FOSi/c1-2-19-29-20-15-25(16-21-29)24-11-7-22(8-12-24)5-3-4-6-23-9-13-26(14-10-23)28-18-17-27/h9-10,13-14,22,24-25,29H,2-8,11-12,15-21H2,1H3 |
| InChIKey | SGNMRCFFLQYDLN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|