C28H44F2Si — CID 54194428
4-[4-[4-[4-(2,2-difluoroethenyl)phenyl]butyl]cyclohexyl]-1-pentylsilinane (PubChem CID 54194428) has the molecular formula C28H44F2Si and a molecular weight of 446.74 g/mol. Its IUPAC name is 4-[4-[4-[4-(2,2-difluoroethenyl)phenyl]butyl]cyclohexyl]-1-pentylsilinane.
| Compound Name | 4-[4-[4-[4-(2,2-difluoroethenyl)phenyl]butyl]cyclohexyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 54194428 |
| Molecular Formula | C28H44F2Si |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 4-[4-[4-[4-(2,2-difluoroethenyl)phenyl]butyl]cyclohexyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(C2CCC(CCCCc3ccc(C=C(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H44F2Si/c1-2-3-6-19-31-20-17-27(18-21-31)26-15-13-24(14-16-26)8-5-4-7-23-9-11-25(12-10-23)22-28(29)30/h9-12,22,24,26-27,31H,2-8,13-21H2,1H3 |
| InChIKey | PKUKUKYTFIWKJZ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|