C26H42F2OSi — CID 54226903
4-[4-[4-[4-(2,2-difluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane (PubChem CID 54226903) has the molecular formula C26H42F2OSi and a molecular weight of 436.70 g/mol. Its IUPAC name is 4-[4-[4-[4-(2,2-difluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane.
| Compound Name | 4-[4-[4-[4-(2,2-difluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane |
|---|---|
| PubChem CID | 54226903 |
| Molecular Formula | C26H42F2OSi |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 4-[4-[4-[4-(2,2-difluoroethoxy)phenyl]butyl]cyclohexyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(C2CCC(CCCCc3ccc(OCC(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H42F2OSi/c1-2-17-30-18-15-24(16-19-30)23-11-7-21(8-12-23)5-3-4-6-22-9-13-25(14-10-22)29-20-26(27)28/h9-10,13-14,21,23-24,26,30H,2-8,11-12,15-20H2,1H3 |
| InChIKey | QGMCLIMWXAGQBS-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|