C23H37FSi — CID 54111665
4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]-1-(2-methylpropyl)silinane (PubChem CID 54111665) has the molecular formula C23H37FSi and a molecular weight of 360.63 g/mol. Its IUPAC name is 4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]-1-(2-methylpropyl)silinane.
| Compound Name | 4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]-1-(2-methylpropyl)silinane |
|---|---|
| PubChem CID | 54111665 |
| Molecular Formula | C23H37FSi |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]-1-(2-methylpropyl)silinane |
| SMILES | CC(C)C[SiH]1CCC(C2CCC(CCc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H37FSi/c1-18(2)17-25-15-13-22(14-16-25)21-9-5-19(6-10-21)3-4-20-7-11-23(24)12-8-20/h7-8,11-12,18-19,21-22,25H,3-6,9-10,13-17H2,1-2H3 |
| InChIKey | NHODOHSGXCMOOO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|