C16H19Cl2F — CID 18656204
1-chloro-4-[2-[4-[(E)-2-chloroethenyl]cyclohexyl]ethyl]-2-fluorobenzene (PubChem CID 18656204) has the molecular formula C16H19Cl2F and a molecular weight of 301.23 g/mol. Its IUPAC name is 1-chloro-4-[2-[4-[(E)-2-chloroethenyl]cyclohexyl]ethyl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[2-[4-[(E)-2-chloroethenyl]cyclohexyl]ethyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 18656204 |
| Molecular Formula | C16H19Cl2F |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-chloro-4-[2-[4-[(E)-2-chloroethenyl]cyclohexyl]ethyl]-2-fluorobenzene |
| SMILES | Fc1cc(CCC2CCC(/C=C/Cl)CC2)ccc1Cl |
| InChI | InChI=1S/C16H19Cl2F/c17-10-9-13-3-1-12(2-4-13)5-6-14-7-8-15(18)16(19)11-14/h7-13H,1-6H2/b10-9+ |
| InChIKey | LEJBZOLMYRKUPB-MDZDMXLPSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |