C28H30O7S — CID 102243696
[3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-yl] 4-methylbenzenesulfonate (PubChem CID 102243696) has the molecular formula C28H30O7S and a molecular weight of 510.61 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102243696 |
| Molecular Formula | C28H30O7S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)cyclopent-2-en-1-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C2=C(c3cc(OC)c(OC)c(OC)c3)C(OS(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30O7S/c1-18-6-12-22(13-7-18)36(29,30)35-24-15-14-23(19-8-10-21(31-2)11-9-19)27(24)20-16-25(32-3)28(34-5)26(17-20)33-4/h6-13,16-17,24H,14-15H2,1-5H3 |
| InChIKey | KOUJBSZWISLVSQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|