C21H22N2O4S — CID 132529606
11,12-dimethoxy-7-methyl-2-(4-methylphenyl)sulfonyl-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene (PubChem CID 132529606) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 11,12-dimethoxy-7-methyl-2-(4-methylphenyl)sulfonyl-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene.
| Compound Name | 11,12-dimethoxy-7-methyl-2-(4-methylphenyl)sulfonyl-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene |
|---|---|
| PubChem CID | 132529606 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 11,12-dimethoxy-7-methyl-2-(4-methylphenyl)sulfonyl-2,6-diazatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene |
| SMILES | COc1cc2cc(C)nc3c2c(c1OC)N(S(=O)(=O)c1ccc(C)cc1)CC3 |
| InChI | InChI=1S/C21H22N2O4S/c1-13-5-7-16(8-6-13)28(24,25)23-10-9-17-19-15(11-14(2)22-17)12-18(26-3)21(27-4)20(19)23/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | FGSTWVWNDBQLKD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |