C32H32N4O8S2 — CID 102109813
3,6-bis(3,4-dimethoxyphenyl)-1,4-bis-(4-methylphenyl)sulfonyl-1,2,4,5-tetrazine (PubChem CID 102109813) has the molecular formula C32H32N4O8S2 and a molecular weight of 664.76 g/mol. Its IUPAC name is 3,6-bis(3,4-dimethoxyphenyl)-1,4-bis-(4-methylphenyl)sulfonyl-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(3,4-dimethoxyphenyl)-1,4-bis-(4-methylphenyl)sulfonyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 102109813 |
| Molecular Formula | C32H32N4O8S2 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.17 |
| IUPAC Name | 3,6-bis(3,4-dimethoxyphenyl)-1,4-bis-(4-methylphenyl)sulfonyl-1,2,4,5-tetrazine |
| SMILES | COc1ccc(C2=NN(S(=O)(=O)c3ccc(C)cc3)C(c3ccc(OC)c(OC)c3)=NN2S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C32H32N4O8S2/c1-21-7-13-25(14-8-21)45(37,38)35-31(23-11-17-27(41-3)29(19-23)43-5)34-36(46(39,40)26-15-9-22(2)10-16-26)32(33-35)24-12-18-28(42-4)30(20-24)44-6/h7-20H,1-6H3 |
| InChIKey | JYAHWKFFIJARDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 136.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |