C22H23NO4S — CID 4626268
3,4-dimethoxy-N,N-bis(4-methylphenyl)benzenesulfonamide (PubChem CID 4626268) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3,4-dimethoxy-N,N-bis(4-methylphenyl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N,N-bis(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4626268 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3,4-dimethoxy-N,N-bis(4-methylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(c2ccc(C)cc2)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C22H23NO4S/c1-16-5-9-18(10-6-16)23(19-11-7-17(2)8-12-19)28(24,25)20-13-14-21(26-3)22(15-20)27-4/h5-15H,1-4H3 |
| InChIKey | JBTWKZVQXXVHAJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |