C17H19NO5S — CID 174695598
3,4-dimethoxy-N-methyl-N-(4-methylphenyl)sulfonylbenzamide (PubChem CID 174695598) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 3,4-dimethoxy-N-methyl-N-(4-methylphenyl)sulfonylbenzamide.
| Compound Name | 3,4-dimethoxy-N-methyl-N-(4-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 174695598 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3,4-dimethoxy-N-methyl-N-(4-methylphenyl)sulfonylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H19NO5S/c1-12-5-8-14(9-6-12)24(20,21)18(2)17(19)13-7-10-15(22-3)16(11-13)23-4/h5-11H,1-4H3 |
| InChIKey | RVETYHBSAIMPNE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |