C25H28N2O5S2 — CID 2972175
4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide (PubChem CID 2972175) has the molecular formula C25H28N2O5S2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 2972175 |
| Molecular Formula | C25H28N2O5S2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)NCCSc3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C25H28N2O5S2/c1-18-5-11-21(12-6-18)33-16-15-26-25(28)19-7-9-20(10-8-19)27(2)34(29,30)22-13-14-23(31-3)24(17-22)32-4/h5-14,17H,15-16H2,1-4H3,(H,26,28) |
| InChIKey | IDPLDJKGZKFQRX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|