C26H30N2O5S2 — CID 3512249
4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 3512249) has the molecular formula C26H30N2O5S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 3512249 |
| Molecular Formula | C26H30N2O5S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)NCCSCc3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C26H30N2O5S2/c1-19-5-7-20(8-6-19)18-34-16-15-27-26(29)21-9-11-22(12-10-21)28(2)35(30,31)23-13-14-24(32-3)25(17-23)33-4/h5-14,17H,15-16,18H2,1-4H3,(H,27,29) |
| InChIKey | HZLZPHATNCPAPB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|