C20H26N2O5S — CID 126388487
4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N,N-diethylbenzamide (PubChem CID 126388487) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N,N-diethylbenzamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 126388487 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(C)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-6-22(7-2)20(23)15-8-10-16(11-9-15)21(3)28(24,25)17-12-13-18(26-4)19(14-17)27-5/h8-14H,6-7H2,1-5H3 |
| InChIKey | OUBZJOLVXKEGBN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |