C12H14N2O5S — CID 13399571
2-(3,4-dimethoxyphenyl)sulfonyl-5-methyl-4H-pyrazol-3-one (PubChem CID 13399571) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonyl-5-methyl-4H-pyrazol-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonyl-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 13399571 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonyl-5-methyl-4H-pyrazol-3-one |
| SMILES | COc1ccc(S(=O)(=O)N2N=C(C)CC2=O)cc1OC |
| InChI | InChI=1S/C12H14N2O5S/c1-8-6-12(15)14(13-8)20(16,17)9-4-5-10(18-2)11(7-9)19-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | CKZAAURHYIYMHL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |