C30H36N2O8S — CID 57114259
N'-[2,5-bis(3,4,5-trimethoxyphenyl)cyclopenten-1-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 57114259) has the molecular formula C30H36N2O8S and a molecular weight of 584.69 g/mol. Its IUPAC name is N'-[2,5-bis(3,4,5-trimethoxyphenyl)cyclopenten-1-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[2,5-bis(3,4,5-trimethoxyphenyl)cyclopenten-1-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 57114259 |
| Molecular Formula | C30H36N2O8S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N'-[2,5-bis(3,4,5-trimethoxyphenyl)cyclopenten-1-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | COc1cc(C2=C(NNS(=O)(=O)c3ccc(C)cc3)C(c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N2O8S/c1-18-8-10-21(11-9-18)41(33,34)32-31-28-22(19-14-24(35-2)29(39-6)25(15-19)36-3)12-13-23(28)20-16-26(37-4)30(40-7)27(17-20)38-5/h8-11,14-17,22,31-32H,12-13H2,1-7H3 |
| InChIKey | WQGGJYGYKKGKMV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|