C30H36N2O8S — CID 67914094
N-[[(2S,5S)-2,5-bis(3,4,5-trimethoxyphenyl)cyclopentylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 67914094) has the molecular formula C30H36N2O8S and a molecular weight of 584.69 g/mol. Its IUPAC name is N-[[(2S,5S)-2,5-bis(3,4,5-trimethoxyphenyl)cyclopentylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2S,5S)-2,5-bis(3,4,5-trimethoxyphenyl)cyclopentylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67914094 |
| Molecular Formula | C30H36N2O8S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N-[[(2S,5S)-2,5-bis(3,4,5-trimethoxyphenyl)cyclopentylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | COc1cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)C2=NNS(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N2O8S/c1-18-8-10-21(11-9-18)41(33,34)32-31-28-22(19-14-24(35-2)29(39-6)25(15-19)36-3)12-13-23(28)20-16-26(37-4)30(40-7)27(17-20)38-5/h8-11,14-17,22-23,32H,12-13H2,1-7H3/t22-,23-/m0/s1 |
| InChIKey | OCMYOELEDYGVSO-GOTSBHOMSA-N |
| XLogP | 5.04 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|