C15H22N2O2S — CID 59365939
N-[(4,4-dimethylcyclohexylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 59365939) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[(4,4-dimethylcyclohexylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4,4-dimethylcyclohexylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 59365939 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(4,4-dimethylcyclohexylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CCC(C)(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O2S/c1-12-4-6-14(7-5-12)20(18,19)17-16-13-8-10-15(2,3)11-9-13/h4-7,17H,8-11H2,1-3H3 |
| InChIKey | HKVYGBXHFFADLU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|