C12H16N2O3S — CID 5465868
4-methyl-N-[(E)-oxan-3-ylideneamino]benzenesulfonamide (PubChem CID 5465868) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-methyl-N-[(E)-oxan-3-ylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-oxan-3-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5465868 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-methyl-N-[(E)-oxan-3-ylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCCOC2)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c1-10-4-6-12(7-5-10)18(15,16)14-13-11-3-2-8-17-9-11/h4-7,14H,2-3,8-9H2,1H3/b13-11+ |
| InChIKey | MXIWQUZCROYPLE-ACCUITESSA-N |
| XLogP | 1.44 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|