C15H24N3O2S+ — CID 7115137
4-methyl-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzenesulfonamide (PubChem CID 7115137) has the molecular formula C15H24N3O2S+ and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-methyl-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 7115137 |
| Molecular Formula | C15H24N3O2S+ |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-methyl-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzenesulfonamide |
| SMILES | CCC[NH+]1CCC(=NNS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C15H23N3O2S/c1-3-10-18-11-8-14(9-12-18)16-17-21(19,20)15-6-4-13(2)5-7-15/h4-7,17H,3,8-12H2,1-2H3/p+1 |
| InChIKey | YGKVABICYIWSKD-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|