C20H26N3O3S+ — CID 9078378
N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-4-ethoxybenzenesulfonamide (PubChem CID 9078378) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 9078378 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NN=C2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-2-26-19-8-10-20(11-9-19)27(24,25)22-21-18-12-14-23(15-13-18)16-17-6-4-3-5-7-17/h3-11,22H,2,12-16H2,1H3/p+1 |
| InChIKey | MJIBDHULWSXDEY-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|