C15H22N3O2+ — CID 6949920
ethyl N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]carbamate (PubChem CID 6949920) has the molecular formula C15H22N3O2+ and a molecular weight of 276.36 g/mol. Its IUPAC name is ethyl N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]carbamate.
| Compound Name | ethyl N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]carbamate |
|---|---|
| PubChem CID | 6949920 |
| Molecular Formula | C15H22N3O2+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]carbamate |
| SMILES | CCOC(=O)NN=C1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-20-15(19)17-16-14-8-10-18(11-9-14)12-13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3,(H,17,19)/p+1 |
| InChIKey | RRRQTCVPAYFPQF-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|