C14H20N3O+ — CID 7675163
N-[(1-ethylpiperidin-1-ium-4-ylidene)amino]benzamide (PubChem CID 7675163) has the molecular formula C14H20N3O+ and a molecular weight of 246.33 g/mol. Its IUPAC name is N-[(1-ethylpiperidin-1-ium-4-ylidene)amino]benzamide.
| Compound Name | N-[(1-ethylpiperidin-1-ium-4-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 7675163 |
| Molecular Formula | C14H20N3O+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-[(1-ethylpiperidin-1-ium-4-ylidene)amino]benzamide |
| SMILES | CC[NH+]1CCC(=NNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H19N3O/c1-2-17-10-8-13(9-11-17)15-16-14(18)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,16,18)/p+1 |
| InChIKey | FBMCTNNWCWFLDU-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|