C15H21N4O3+ — CID 7102753
3-nitro-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzamide (PubChem CID 7102753) has the molecular formula C15H21N4O3+ and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-nitro-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzamide.
| Compound Name | 3-nitro-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 7102753 |
| Molecular Formula | C15H21N4O3+ |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-nitro-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]benzamide |
| SMILES | CCC[NH+]1CCC(=NNC(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C15H20N4O3/c1-2-8-18-9-6-13(7-10-18)16-17-15(20)12-4-3-5-14(11-12)19(21)22/h3-5,11H,2,6-10H2,1H3,(H,17,20)/p+1 |
| InChIKey | KUFMKAOVPOKKHS-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|