C15H19N3O3 — CID 9015889
N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitrobenzamide (PubChem CID 9015889) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitrobenzamide.
| Compound Name | N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9015889 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitrobenzamide |
| SMILES | C[C@@H]1CCC[C@H](C)/C1=N\NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-5-3-6-11(2)14(10)16-17-15(19)12-7-4-8-13(9-12)18(20)21/h4,7-11H,3,5-6H2,1-2H3,(H,17,19)/b16-14-/t10-,11+/m1/s1 |
| InChIKey | AEQCSZNTLMAKNG-RMTVOJOISA-N |
| XLogP | 3.14 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|