C14H19N3O2 — CID 9077133
N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitroaniline (PubChem CID 9077133) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitroaniline.
| Compound Name | N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitroaniline |
|---|---|
| PubChem CID | 9077133 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[[(2S,6R)-2,6-dimethylcyclohexylidene]amino]-3-nitroaniline |
| SMILES | C[C@@H]1CCC[C@H](C)/C1=N/Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O2/c1-10-5-3-6-11(2)14(10)16-15-12-7-4-8-13(9-12)17(18)19/h4,7-11,15H,3,5-6H2,1-2H3/b16-14-/t10-,11+/m0/s1 |
| InChIKey | CYKFNMKWZTWJDK-FRROQNSTSA-N |
| XLogP | 3.82 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|