C14H19N3O2 — CID 165364389
N-[1-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]ethenyl]-3-nitroaniline (PubChem CID 165364389) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[1-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]ethenyl]-3-nitroaniline.
| Compound Name | N-[1-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]ethenyl]-3-nitroaniline |
|---|---|
| PubChem CID | 165364389 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[1-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]ethenyl]-3-nitroaniline |
| SMILES | C=C(Nc1cccc([N+](=O)[O-])c1)N1[C@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C14H19N3O2/c1-10-7-8-11(2)16(10)12(3)15-13-5-4-6-14(9-13)17(18)19/h4-6,9-11,15H,3,7-8H2,1-2H3/t10-,11+ |
| InChIKey | NSMNIDMTZMYKNT-PHIMTYICSA-N |
| XLogP | 3.35 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|