C15H22N4O2 — CID 111144184
N',3-dimethyl-N-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide (PubChem CID 111144184) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N',3-dimethyl-N-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111144184 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N',3-dimethyl-N-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)N1CCCC(C)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-12-5-4-8-18(11-12)15(16-2)17-10-13-6-3-7-14(9-13)19(20)21/h3,6-7,9,12H,4-5,8,10-11H2,1-2H3,(H,16,17) |
| InChIKey | OGUWMJBXWUKPSX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|