C20H31IN6O3 — CID 111419834
N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111419834) has the molecular formula C20H31IN6O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111419834 |
| Molecular Formula | C20H31IN6O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc([N+](=O)[O-])c1)N1CCN(CC(=O)N2CCCCC2)CC1.I |
| InChI | InChI=1S/C20H30N6O3.HI/c1-21-20(22-15-17-6-5-7-18(14-17)26(28)29)25-12-10-23(11-13-25)16-19(27)24-8-3-2-4-9-24;/h5-7,14H,2-4,8-13,15-16H2,1H3,(H,21,22);1H |
| InChIKey | QDYSJMUSYUXALA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|