C20H23IN4O2 — CID 111263714
N'-methyl-N-[(3-nitrophenyl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide (PubChem CID 111263714) has the molecular formula C20H23IN4O2 and a molecular weight of 478.33 g/mol. Its IUPAC name is N'-methyl-N-[(3-nitrophenyl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111263714 |
| Molecular Formula | C20H23IN4O2 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc([N+](=O)[O-])c1)N1CC=C(c2ccccc2)CC1.I |
| InChI | InChI=1S/C20H22N4O2.HI/c1-21-20(22-15-16-6-5-9-19(14-16)24(25)26)23-12-10-18(11-13-23)17-7-3-2-4-8-17;/h2-10,14H,11-13,15H2,1H3,(H,21,22);1H |
| InChIKey | HHRSAXQSIDIQKU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|