C20H24N4O2S — CID 111748830
N'-methyl-N-[(3-nitrophenyl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748830) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is N'-methyl-N-[(3-nitrophenyl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(3-nitrophenyl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748830 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N'-methyl-N-[(3-nitrophenyl)methyl]-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N4O2S/c1-21-20(22-13-16-6-5-7-18(12-16)24(25)26)23-11-10-17(14-23)15-27-19-8-3-2-4-9-19/h2-9,12,17H,10-11,13-15H2,1H3,(H,21,22) |
| InChIKey | ODYGSBBIPHMAER-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|