C21H25IN4S — CID 111749292
N-[(3-cyanophenyl)methyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111749292) has the molecular formula C21H25IN4S and a molecular weight of 492.43 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3-cyanophenyl)methyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111749292 |
| Molecular Formula | C21H25IN4S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-N'-methyl-3-(phenylsulfanylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C#N)c1)N1CCC(CSc2ccccc2)C1.I |
| InChI | InChI=1S/C21H24N4S.HI/c1-23-21(24-14-18-7-5-6-17(12-18)13-22)25-11-10-19(15-25)16-26-20-8-3-2-4-9-20;/h2-9,12,19H,10-11,14-16H2,1H3,(H,23,24);1H |
| InChIKey | IGRMJQWFKZPACX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|