C21H28IN5O3 — CID 111363356
N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-phenoxyethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111363356) has the molecular formula C21H28IN5O3 and a molecular weight of 525.39 g/mol. Its IUPAC name is N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-phenoxyethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-phenoxyethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111363356 |
| Molecular Formula | C21H28IN5O3 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N'-methyl-N-[(3-nitrophenyl)methyl]-4-(2-phenoxyethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc([N+](=O)[O-])c1)N1CCN(CCOc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H27N5O3.HI/c1-22-21(23-17-18-6-5-7-19(16-18)26(27)28)25-12-10-24(11-13-25)14-15-29-20-8-3-2-4-9-20;/h2-9,16H,10-15,17H2,1H3,(H,22,23);1H |
| InChIKey | GCJXBIKORBWRQL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|