C21H33IN6O3 — CID 111419624
4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111419624) has the molecular formula C21H33IN6O3 and a molecular weight of 544.44 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111419624 |
| Molecular Formula | C21H33IN6O3 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc([N+](=O)[O-])c1)N1CCN(CC(=O)N2CCCCCC2)CC1.I |
| InChI | InChI=1S/C21H32N6O3.HI/c1-22-21(23-16-18-7-6-8-19(15-18)27(29)30)26-13-11-24(12-14-26)17-20(28)25-9-4-2-3-5-10-25;/h6-8,15H,2-5,9-14,16-17H2,1H3,(H,22,23);1H |
| InChIKey | HGGBAKBFSLFPOV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|