C16H21N3O2 — CID 9077283
N-[(E)-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-3-nitroaniline (PubChem CID 9077283) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[(E)-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-3-nitroaniline.
| Compound Name | N-[(E)-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-3-nitroaniline |
|---|---|
| PubChem CID | 9077283 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[(E)-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-3-nitroaniline |
| SMILES | O=[N+]([O-])c1cccc(N/N=C2\CC[C@@H]3CCCC[C@H]3C2)c1 |
| InChI | InChI=1S/C16H21N3O2/c20-19(21)16-7-3-6-14(11-16)17-18-15-9-8-12-4-1-2-5-13(12)10-15/h3,6-7,11-13,17H,1-2,4-5,8-10H2/b18-15+/t12-,13-/m0/s1 |
| InChIKey | PQHKLBCSEMQEPJ-PTTFWAKNSA-N |
| XLogP | 4.35 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|