About N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide
N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide (PubChem CID 9072634) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide |
| PubChem CID | 9072634 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide |
| SMILES | C[C@@H]1CCC[C@@H](C)C1=NNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H20N2O2/c1-10-4-3-5-11(2)14(10)16-17-15(19)12-6-8-13(18)9-7-12/h6-11,18H,3-5H2,1-2H3,(H,17,19)/t10-,11-/m1/s1 |
| InChIKey | GBRLBFCKYKWGEE-GHMZBOCLSA-N |
| XLogP | 2.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide?
The IUPAC name of N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide (CID 9072634) is N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide.
What is the SMILES notation for N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide?
The canonical SMILES for N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide is C[C@@H]1CCC[C@@H](C)C1=NNC(=O)c1ccc(O)cc1.
What is the InChIKey of N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide?
The InChIKey is GBRLBFCKYKWGEE-GHMZBOCLSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-10-4-3-5-11(2)14(10)16-17-15(19)12-6-8-13(18)9-7-12/h6-11,18H,3-5H2,1-2H3,(H,17,19)/t10-,11-/m1/s1.
What are the key properties of N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide?
N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide has a molecular weight of 260.34 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide is sourced from PubChem (CID 9072634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).