C15H20N2O2 — CID 9072634
N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide (PubChem CID 9072634) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide.
| Compound Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 9072634 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-4-hydroxybenzamide |
| SMILES | C[C@@H]1CCC[C@@H](C)C1=NNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H20N2O2/c1-10-4-3-5-11(2)14(10)16-17-15(19)12-6-8-13(18)9-7-12/h6-11,18H,3-5H2,1-2H3,(H,17,19)/t10-,11-/m1/s1 |
| InChIKey | GBRLBFCKYKWGEE-GHMZBOCLSA-N |
| XLogP | 2.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|