C16H12FN3O5S — CID 6529446
N-[(Z)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-3-nitrobenzamide (PubChem CID 6529446) has the molecular formula C16H12FN3O5S and a molecular weight of 377.35 g/mol. Its IUPAC name is N-[(Z)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 6529446 |
| Molecular Formula | C16H12FN3O5S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[(Z)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-3-nitrobenzamide |
| SMILES | O=C(N/N=C1/CCS(=O)(=O)c2ccc(F)cc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12FN3O5S/c17-11-4-5-15-13(9-11)14(6-7-26(15,24)25)18-19-16(21)10-2-1-3-12(8-10)20(22)23/h1-5,8-9H,6-7H2,(H,19,21)/b18-14- |
| InChIKey | JDTPVBLTUMHBLX-JXAWBTAJSA-N |
| XLogP | 2.05 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|