C15H11F2N3O3 — CID 9016019
N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-3-nitrobenzamide (PubChem CID 9016019) has the molecular formula C15H11F2N3O3 and a molecular weight of 319.27 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9016019 |
| Molecular Formula | C15H11F2N3O3 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-3-nitrobenzamide |
| SMILES | C/C(=N/NC(=O)c1cccc([N+](=O)[O-])c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H11F2N3O3/c1-9(13-8-11(16)5-6-14(13)17)18-19-15(21)10-3-2-4-12(7-10)20(22)23/h2-8H,1H3,(H,19,21)/b18-9- |
| InChIKey | QFIFBTPEQUYBCR-NVMNQCDNSA-N |
| XLogP | 3.03 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|