C15H12F2N2O — CID 86621112
2,5-difluoro-N-[(Z)-1-phenylethylideneamino]benzamide (PubChem CID 86621112) has the molecular formula C15H12F2N2O and a molecular weight of 274.27 g/mol. Its IUPAC name is 2,5-difluoro-N-[(Z)-1-phenylethylideneamino]benzamide.
| Compound Name | 2,5-difluoro-N-[(Z)-1-phenylethylideneamino]benzamide |
|---|---|
| PubChem CID | 86621112 |
| Molecular Formula | C15H12F2N2O |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,5-difluoro-N-[(Z)-1-phenylethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1cc(F)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C15H12F2N2O/c1-10(11-5-3-2-4-6-11)18-19-15(20)13-9-12(16)7-8-14(13)17/h2-9H,1H3,(H,19,20)/b18-10- |
| InChIKey | XJMWOSKMWUULEN-ZDLGFXPLSA-N |
| XLogP | 3.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|