C13H17N4O3+ — CID 4745365
N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-3-nitrobenzohydrazide (PubChem CID 4745365) has the molecular formula C13H17N4O3+ and a molecular weight of 277.30 g/mol. Its IUPAC name is N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-3-nitrobenzohydrazide.
| Compound Name | N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4745365 |
| Molecular Formula | C13H17N4O3+ |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N'-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)-3-nitrobenzohydrazide |
| SMILES | C[NH+]1CC=C(NNC(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H16N4O3/c1-16-7-5-11(6-8-16)14-15-13(18)10-3-2-4-12(9-10)17(19)20/h2-5,9,14H,6-8H2,1H3,(H,15,18)/p+1 |
| InChIKey | TUDDSYKUEAIMEE-UHFFFAOYSA-O |
| XLogP | -0.37 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|