C24H32N3O2+ — CID 7800597
N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-2-(4-tert-butylphenoxy)acetamide (PubChem CID 7800597) has the molecular formula C24H32N3O2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 7800597 |
| Molecular Formula | C24H32N3O2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | N-[(1-benzylpiperidin-1-ium-4-ylidene)amino]-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NN=C2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-24(2,3)20-9-11-22(12-10-20)29-18-23(28)26-25-21-13-15-27(16-14-21)17-19-7-5-4-6-8-19/h4-12H,13-18H2,1-3H3,(H,26,28)/p+1 |
| InChIKey | HARZCGMZGVYQJL-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|