C21H24N2O2 — CID 7929753
2-(4-tert-butylphenoxy)-N-[(Z)-2,3-dihydroinden-1-ylideneamino]acetamide (PubChem CID 7929753) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(Z)-2,3-dihydroinden-1-ylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(Z)-2,3-dihydroinden-1-ylideneamino]acetamide |
|---|---|
| PubChem CID | 7929753 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(Z)-2,3-dihydroinden-1-ylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C2/CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-21(2,3)16-9-11-17(12-10-16)25-14-20(24)23-22-19-13-8-15-6-4-5-7-18(15)19/h4-7,9-12H,8,13-14H2,1-3H3,(H,23,24)/b22-19- |
| InChIKey | ZYJSCUPVPUQINS-QOCHGBHMSA-N |
| XLogP | 3.83 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|