C26H30N4O4S2 — CID 125034492
4-methyl-N-[[(1S,4R,6S,9R)-12-[(4-methylphenyl)sulfonylhydrazinylidene]-5-tetracyclo[7.2.1.04,11.06,10]dodecanylidene]amino]benzenesulfonamide (PubChem CID 125034492) has the molecular formula C26H30N4O4S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is 4-methyl-N-[[(1S,4R,6S,9R)-12-[(4-methylphenyl)sulfonylhydrazinylidene]-5-tetracyclo[7.2.1.04,11.06,10]dodecanylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(1S,4R,6S,9R)-12-[(4-methylphenyl)sulfonylhydrazinylidene]-5-tetracyclo[7.2.1.04,11.06,10]dodecanylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 125034492 |
| Molecular Formula | C26H30N4O4S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 4-methyl-N-[[(1S,4R,6S,9R)-12-[(4-methylphenyl)sulfonylhydrazinylidene]-5-tetracyclo[7.2.1.04,11.06,10]dodecanylidene]amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/[C@H]3CC[C@H]4/C(=N\NS(=O)(=O)c5ccc(C)cc5)[C@H]5CC[C@@H]2C5C34)cc1 |
| InChI | InChI=1S/C26H30N4O4S2/c1-15-3-7-17(8-4-15)35(31,32)29-27-25-19-11-13-21-23(19)24-20(25)12-14-22(24)26(21)28-30-36(33,34)18-9-5-16(2)6-10-18/h3-10,19-24,29-30H,11-14H2,1-2H3/b27-25-,28-26+/t19-,20+,21+,22-,23?,24?/m0/s1 |
| InChIKey | JTKBHKRNPFIMRJ-YIWNAUOMSA-N |
| XLogP | 3.58 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|