C22H27N3O5S2 — CID 59902657
N-[[6-hydroxy-3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 59902657) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[[6-hydroxy-3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[6-hydroxy-3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 59902657 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[[6-hydroxy-3-(4-methylphenyl)sulfonyl-3-azabicyclo[3.3.1]nonan-9-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2C3CCC(O)C2CN(S(=O)(=O)c2ccc(C)cc2)C3)cc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-15-3-8-18(9-4-15)31(27,28)24-23-22-17-7-12-21(26)20(22)14-25(13-17)32(29,30)19-10-5-16(2)6-11-19/h3-6,8-11,17,20-21,24,26H,7,12-14H2,1-2H3 |
| InChIKey | HWMVHMIVOQAREK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|