C15H22N2O3S — CID 91885680
N-[(E)-[(2R,3S)-2-ethyl-3-hydroxycyclohexylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 91885680) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[(E)-[(2R,3S)-2-ethyl-3-hydroxycyclohexylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(2R,3S)-2-ethyl-3-hydroxycyclohexylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91885680 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[(E)-[(2R,3S)-2-ethyl-3-hydroxycyclohexylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1/C(=N/NS(=O)(=O)c2ccc(C)cc2)CCC[C@@H]1O |
| InChI | InChI=1S/C15H22N2O3S/c1-3-13-14(5-4-6-15(13)18)16-17-21(19,20)12-9-7-11(2)8-10-12/h7-10,13,15,17-18H,3-6H2,1-2H3/b16-14+/t13-,15+/m1/s1 |
| InChIKey | LJRFAWHFYRQJAV-PODIUQQRSA-N |
| XLogP | 2.20 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|