C18H22N2O6S — CID 146019904
N-[(2,9-dioxo-3,3a,5,6,7,8,11,11a-octahydrofuro[2,3-c]oxecin-4-ylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 146019904) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[(2,9-dioxo-3,3a,5,6,7,8,11,11a-octahydrofuro[2,3-c]oxecin-4-ylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2,9-dioxo-3,3a,5,6,7,8,11,11a-octahydrofuro[2,3-c]oxecin-4-ylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 146019904 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[(2,9-dioxo-3,3a,5,6,7,8,11,11a-octahydrofuro[2,3-c]oxecin-4-ylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CCCCC(=O)OCC3OC(=O)CC23)cc1 |
| InChI | InChI=1S/C18H22N2O6S/c1-12-6-8-13(9-7-12)27(23,24)20-19-15-4-2-3-5-17(21)25-11-16-14(15)10-18(22)26-16/h6-9,14,16,20H,2-5,10-11H2,1H3 |
| InChIKey | NFHCDFMUMSIVHF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|