C27H34O8S2 — CID 162411761
[(2'R,3'R,3'aS,6'aS)-5,5-dimethyl-3'-(4-methylphenyl)sulfonyloxyspiro[1,3-dioxane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene]-2'-yl] 4-methylbenzenesulfonate (PubChem CID 162411761) has the molecular formula C27H34O8S2 and a molecular weight of 550.70 g/mol. Its IUPAC name is [(2'R,3'R,3'aS,6'aS)-5,5-dimethyl-3'-(4-methylphenyl)sulfonyloxyspiro[1,3-dioxane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene]-2'-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2'R,3'R,3'aS,6'aS)-5,5-dimethyl-3'-(4-methylphenyl)sulfonyloxyspiro[1,3-dioxane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene]-2'-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162411761 |
| Molecular Formula | C27H34O8S2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | [(2'R,3'R,3'aS,6'aS)-5,5-dimethyl-3'-(4-methylphenyl)sulfonyloxyspiro[1,3-dioxane-2,6'-2,3,3a,4,5,6a-hexahydro-1H-pentalene]-2'-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H]3CCC4(OCC(C)(C)CO4)[C@H]3C[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H34O8S2/c1-18-5-9-20(10-6-18)36(28,29)34-24-15-23-22(13-14-27(23)32-16-26(3,4)17-33-27)25(24)35-37(30,31)21-11-7-19(2)8-12-21/h5-12,22-25H,13-17H2,1-4H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | FQURBUOENJEKJD-CXSMSNRLSA-N |
| XLogP | 4.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|